CAS 182115-55-5 is the registry number for 3-Hydroxy-2,3-dihydro-4h-furo[3,2-c]chromen-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-hydroxy-2,3-dihydrofuro[3,2-c]chromen-4-one (CAS 182115-55-5) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 3-hydroxy-2,3-dihydrofuro[3,2-c]chromen-4-one. InChIKey: BGEWTPOASROOHX-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-hydroxy-2,3-dihydrofuro[3,2-c]chromen-4-one |
| InChIKey | BGEWTPOASROOHX-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C3=CC=CC=C3OC2=O)O |
Computed by PubChem (NCBI)