cas: 27182-54-3 — see every product listed under this CAS number, including other names
5-Phenyl-1,2,4-thiadiazol-3-amine, 97% (CAS 27182-54-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A755613-10g |
| cas | 27182-54-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8702.26 Pln | |
| AmBeed | 100mg | 571.27 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-phenyl-1,2,4-thiadiazol-3-amine (CAS 27182-54-3) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 5-phenyl-1,2,4-thiadiazol-3-amine. InChIKey: WOZDQVLZCXNJPY-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 5-phenyl-1,2,4-thiadiazol-3-amine |
| InChIKey | WOZDQVLZCXNJPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NS2)N |
Computed by PubChem (NCBI)