Products 6636-06-2
CAS 6636-06-2 appears in our catalog under these names: 5-Phenyl-1H-pyrrole-2-carboxylic acid, 97%, 97%, 5-Phenyl-1 H -pyrrole-2-carboxylic acid, ≥97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-phenyl-1H-pyrrole-2-carboxylic acid (CAS 6636-06-2) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 5-phenyl-1H-pyrrole-2-carboxylic acid. InChIKey: YEQVNAGNEONSTR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-phenyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | YEQVNAGNEONSTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(N2)C(=O)O |
Computed by PubChem (NCBI)