cas: 1400191-58-3 — see every product listed under this CAS number, including other names
5-Phenyl-3-(o-tolyl)-1,2,4-oxadiazole, 98%, 98% (CAS 1400191-58-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FANV-100mg |
| cas | 1400191-58-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1221.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(2-methylphenyl)-5-phenyl-1,2,4-oxadiazole (CAS 1400191-58-3) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 3-(2-methylphenyl)-5-phenyl-1,2,4-oxadiazole. InChIKey: UPWQKWQWFBYGFM-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 3-(2-methylphenyl)-5-phenyl-1,2,4-oxadiazole |
| InChIKey | UPWQKWQWFBYGFM-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NOC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)