cas: 955-16-8 — see every product listed under this CAS number, including other names
5-Phenylisobenzofuran-1,3-dione, 95%, 95% (CAS 955-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJ6A-100mg |
| cas | 955-16-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1269.20 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-phenyl-2-benzofuran-1,3-dione (CAS 955-16-8) is a chemical compound with the molecular formula C14H8O3 and a molecular weight of 224.21 g/mol. IUPAC name: 5-phenyl-2-benzofuran-1,3-dione. InChIKey: YTRAFABYXOZRDF-UHFFFAOYSA-N.
| Molecular formula | C14H8O3 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 5-phenyl-2-benzofuran-1,3-dione |
| InChIKey | YTRAFABYXOZRDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)C(=O)OC3=O |
Computed by PubChem (NCBI)