CAS 784-50-9 appears in our catalog under these names: 9–Fluorenone–2–carboxylic Acid, 9-Fluorenone-2-carboxylic acid, 9-Fluorenone-2-carboxylic acid, 95%, 9-Fluorenone-2-carboxylic acid, 98%, 9-Fluorenone-2-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, Thermo Scientific (Acros). Available pack sizes: 1g, 25g, 5g, 2g, 10g, 50g, 100mg, 250mg.
9-oxofluorene-2-carboxylic acid (CAS 784-50-9) is a chemical compound with the molecular formula C14H8O3 and a molecular weight of 224.21 g/mol. IUPAC name: 9-oxofluorene-2-carboxylic acid. InChIKey: BJCTXUUKONLPPK-UHFFFAOYSA-N.
| Molecular formula | C14H8O3 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 9-oxofluorene-2-carboxylic acid |
| InChIKey | BJCTXUUKONLPPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)