CAS 5699-00-3 appears in our catalog under these names: 6,7-Dihydroindeno[6,7,1-def]isochromene-1,3-dione, 98%, 6,7-Dihydroacenaphtho(5,6-cd)pyran-1,3-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (CAS 5699-00-3) is a chemical compound with the molecular formula C14H8O3 and a molecular weight of 224.21 g/mol. IUPAC name: 6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione. InChIKey: JDLNUOOGRNIDEQ-UHFFFAOYSA-N.
| Molecular formula | C14H8O3 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 6-oxatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| InChIKey | JDLNUOOGRNIDEQ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C3C4=C(C=CC1=C24)C(=O)OC3=O |
Computed by PubChem (NCBI)