CAS 1573-92-8 appears in our catalog under these names: 9-Fluorenone-1-carboxylic acid, 96%, 9–Fluorenone–1–carboxylic Acid, 9-Fluorenone-1-carboxylic Acid, 9-Fluorenone-1-carboxylic Acid, >98.0%(HPLC)(T), 9-Oxo-9H-fluorene-1-carboxylic acid, ≥98%(HPLC)(T), ≥98%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
9-oxofluorene-1-carboxylic acid (CAS 1573-92-8) is a chemical compound with the molecular formula C14H8O3 and a molecular weight of 224.21 g/mol. IUPAC name: 9-oxofluorene-1-carboxylic acid. InChIKey: CBEFMGJHEKAMNI-UHFFFAOYSA-N.
| Molecular formula | C14H8O3 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 9-oxofluorene-1-carboxylic acid |
| InChIKey | CBEFMGJHEKAMNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)