cas: 10177-12-5 — see every product listed under this CAS number, including other names
5-Phenylnicotinic acid, 98%, 98% (CAS 10177-12-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1116G6-5g |
| cas | 10177-12-5 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2426.00 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 837.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-phenylpyridine-3-carboxylic acid (CAS 10177-12-5) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 5-phenylpyridine-3-carboxylic acid. InChIKey: VKFXHYRIHRTEIV-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 5-phenylpyridine-3-carboxylic acid |
| InChIKey | VKFXHYRIHRTEIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)