5-Phenylpicolinimidamide hydrochloride, 95%
cas: 1179362-50-5 — see every product listed under this CAS number, including other names
5-Phenylpicolinimidamide hydrochloride, 95% (CAS 1179362-50-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-3679-1g |
| cas | 1179362-50-5 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 3418.62 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 842.00 Pln | |
| Chemat | 5g | 3294.80 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 369.89 Pln | |
| BLDpharm | 1g | 791.97 Pln | |
| BLDpharm | 5g | 3679.84 Pln | |
| Fluorochem | 250mg | 586.27 Pln | |
| Fluorochem | 1g | 1559.89 Pln | |
| Fluorochem | 100mg | 299.91 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-phenylpyridine-2-carboximidamide;hydrochloride (CAS 1179362-50-5) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 5-phenylpyridine-2-carboximidamide;hydrochloride. InChIKey: BXHJWKSDJAZAGU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 5-phenylpyridine-2-carboximidamide;hydrochloride |
| InChIKey | BXHJWKSDJAZAGU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C=C2)C(=N)N.Cl |
Computed by PubChem (NCBI)