Products 1036555-53-9
CAS 1036555-53-9 appears in our catalog under these names: 6-Chloro-n-(1-phenylethyl)pyridazin-3-amine, 95%, 6-Chloro-N-(1-phenylethyl)pyridazin-3-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
6-chloro-N-(1-phenylethyl)pyridazin-3-amine (CAS 1036555-53-9) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 6-chloro-N-(1-phenylethyl)pyridazin-3-amine. InChIKey: YTFBVSPYKWRCPP-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 6-chloro-N-(1-phenylethyl)pyridazin-3-amine |
| InChIKey | YTFBVSPYKWRCPP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NC2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)