CAS 936939-36-5 appears in our catalog under these names: 4-(2-Chloropyrimidin-4-yl)-n,n-dimethylaniline, 95%, Pazopanib Impurity 27 . Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 250mg, on request.
4-(2-chloropyrimidin-4-yl)-N,N-dimethylaniline (CAS 936939-36-5) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 4-(2-chloropyrimidin-4-yl)-N,N-dimethylaniline. InChIKey: GMDQJAOYGPFWCR-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 4-(2-chloropyrimidin-4-yl)-N,N-dimethylaniline |
| InChIKey | GMDQJAOYGPFWCR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)