CAS 287481-35-0 appears in our catalog under these names: 4-Aminoazobenzene hydrochloride, 95%, (E)-4-(phenyldiazenyl)aniline hydrochloride, ≥98%(T). Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 1g.
4-phenyldiazenylaniline;hydrochloride (CAS 287481-35-0) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 4-phenyldiazenylaniline;hydrochloride. InChIKey: WMNTYZIRLUBHEE-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 4-phenyldiazenylaniline;hydrochloride |
| InChIKey | WMNTYZIRLUBHEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)