cas: 5711-73-9 — see every product listed under this CAS number, including other names
5-Pyridin-3-yl-1,3,4-oxadiazol-2-ylamine (CAS 5711-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009904-250MG |
| cas | 5711-73-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 500mg | 299.91 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1611.95 Pln | |
| Fluorochem | 10g | 3048.94 Pln |
| delivery time | 2-3 weeks |
|---|
5-pyridin-3-yl-1,3,4-oxadiazol-2-amine (CAS 5711-73-9) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 5-pyridin-3-yl-1,3,4-oxadiazol-2-amine. InChIKey: JMAJFOJPCCULLE-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-pyridin-3-yl-1,3,4-oxadiazol-2-amine |
| InChIKey | JMAJFOJPCCULLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)