cas: 1021868-08-5 — see every product listed under this CAS number, including other names
5-QUINOLINEBORONIC ACID PINACOL ESTER, 98% (CAS 1021868-08-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387465-250MG |
| cas | 1021868-08-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 2.5g | 482.14 Pln | |
| Fluorochem | 5g | 857.01 Pln | |
| Fluorochem | 10g | 1632.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1021868-08-5) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: YXRNJSUZRJEHPV-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | YXRNJSUZRJEHPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=NC3=CC=C2 |
Computed by PubChem (NCBI)