cas: 91809-66-4 — see every product listed under this CAS number, including other names
5-TAMRA 98% (CAS 91809-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1mg, 5mg, 10mg, 25mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A505764-100g |
| cas | 91809-66-4 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 33728.69 Pln | |
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 5mg | 147.88 Pln | |
| Ambeed | 10mg | 164.56 Pln | |
| Ambeed | 25mg | 236.88 Pln | |
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1666.44 Pln | |
| Ambeed | 5g | 4269.69 Pln | |
| Ambeed | 25g | 10588.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A505764 |
5-carboxytetramethylrhodamine is a tetramethylrhodamine compound having a carboxy substituent at the 5-position. It has a role as a fluorochrome.
Source: ChEBI
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 3-carboxy-4-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate |
| InChIKey | YMZMTOFQCVHHFB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)[O-])C(=O)O |
Computed by PubChem (NCBI)