CAS 1675221-59-6 appears in our catalog under these names: Azilsartan Impurity 18, Azilsartan Impurity 58, Azilsartan Impurity 30, 2'-CARBOXY AZILSARTAN METHYL ESTER. Offered by: Chemat Brand, Hubei YoungXin, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-[(2-ethoxy-7-methoxycarbonylbenzimidazol-1-yl)methyl]phenyl]benzoic acid (CAS 1675221-59-6) is a chemical compound with the molecular formula C25H22N2O5 and a molecular weight of 430.5 g/mol. IUPAC name: 2-[4-[(2-ethoxy-7-methoxycarbonylbenzimidazol-1-yl)methyl]phenyl]benzoic acid. InChIKey: GDLRDIRLOKCOSZ-UHFFFAOYSA-N.
| Molecular formula | C25H22N2O5 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 2-[4-[(2-ethoxy-7-methoxycarbonylbenzimidazol-1-yl)methyl]phenyl]benzoic acid |
| InChIKey | GDLRDIRLOKCOSZ-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)O)C(=O)OC |
Computed by PubChem (NCBI)