cas: 1261529-03-6 — see every product listed under this CAS number, including other names
5-aminoquinolin-3-ol, 95%, 95% (CAS 1261529-03-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RUG-100mg |
| cas | 1261529-03-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1590.80 Pln | |
| Chemat | 250mg | 2507.60 Pln | |
| Chemat | 1g | 6424.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-aminoquinolin-3-ol (CAS 1261529-03-6) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-aminoquinolin-3-ol. InChIKey: YMXQIJJAGDBYPH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-aminoquinolin-3-ol |
| InChIKey | YMXQIJJAGDBYPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=C(C=NC2=C1)O)N |
Computed by PubChem (NCBI)