cas: 1114563-10-8 — see every product listed under this CAS number, including other names
5-bromo-1-(2,2,2-trifluoroethyl)pyridin-2(1H)-one, 98%, 98% (CAS 1114563-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103JL-100mg |
| cas | 1114563-10-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 914.00 Pln | |
| Chemat | 1g | 2853.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-(2,2,2-trifluoroethyl)pyridin-2-one (CAS 1114563-10-8) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 5-bromo-1-(2,2,2-trifluoroethyl)pyridin-2-one. InChIKey: BMZLLGYZNDRECU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 5-bromo-1-(2,2,2-trifluoroethyl)pyridin-2-one |
| InChIKey | BMZLLGYZNDRECU-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1Br)CC(F)(F)F |
Computed by PubChem (NCBI)