cas: 1026853-23-5 — see every product listed under this CAS number, including other names
5-tert-Butyl 3-ethyl 4,6-dihydropyrrolo(3,4-c)pyrazole-3,5(1H)-dicarboxylate, 97% (CAS 1026853-23-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A313735-10g |
| cas | 1026853-23-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 18102.70 Pln | |
| AmBeed | 5g | 10876.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-O-tert-butyl 3-O-ethyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3,5-dicarboxylate (CAS 1026853-23-5) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: 5-O-tert-butyl 3-O-ethyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3,5-dicarboxylate. InChIKey: MHWYLDOKAIBUKI-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 5-O-tert-butyl 3-O-ethyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3,5-dicarboxylate |
| InChIKey | MHWYLDOKAIBUKI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC2=C1CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)