cas: 1026853-23-5 — see every product listed under this CAS number, including other names
5-tert-Butyl 3-ethyl 4,6-dihydropyrrolo[3,4-c]pyrazole-3,5(1h)-dicarboxylate, 95% (CAS 1026853-23-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QM-6999-250mg |
| cas | 1026853-23-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 250mg | 893.45 Pln | |
| Fluorochem | 500mg | 1549.47 Pln | |
| Fluorochem | 1g | 2106.57 Pln | |
| Fluorochem | 5g | 8791.71 Pln | |
| Fluorochem | 10g | 14633.41 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-O-tert-butyl 3-O-ethyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3,5-dicarboxylate (CAS 1026853-23-5) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: 5-O-tert-butyl 3-O-ethyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3,5-dicarboxylate. InChIKey: MHWYLDOKAIBUKI-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 5-O-tert-butyl 3-O-ethyl 4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3,5-dicarboxylate |
| InChIKey | MHWYLDOKAIBUKI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC2=C1CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)