5MPN
cas: 47208-82-2 — see every product listed under this CAS number, including other names
5MPN (CAS 47208-82-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 2mg, 100mg, 200mg, 250mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC63956-10 |
| cas | 47208-82-2 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1888.86 Pln | |
| GLPBio | 25mg | 3363.22 Pln | |
| GLPBio | 5mg | 1299.11 Pln | |
| GLPBio | 50mg | 5132.44 Pln | |
| Chemat | 2mg | 731.60 Pln | |
| Chemat | 5mg | 1245.20 Pln | |
| Chemat | 10mg | 2037.20 Pln | |
| Chemat | 25mg | 3285.20 Pln | |
| Chemat | 50mg | 4581.20 Pln | |
| Chemat | 100mg | 6160.40 Pln | |
| Chemat | 200mg | 8253.20 Pln | |
| Chemat | 250mg | 3170.00 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-[(8-methoxyquinolin-4-yl)amino]pentyl nitrate (CAS 47208-82-2) is a chemical compound with the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. IUPAC name: 5-[(8-methoxyquinolin-4-yl)amino]pentyl nitrate. InChIKey: YBOILUNNGBGURC-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O4 |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | 5-[(8-methoxyquinolin-4-yl)amino]pentyl nitrate |
| InChIKey | YBOILUNNGBGURC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C(C=CN=C21)NCCCCCO[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
5MPN compound, orb3027311