CAS 930495-18-4 is the registry number for 1-(2-Methylpropyl)-2,4-dioxo-7-(propan-2-yl)-1H,2H,3H,4H-pyrido(2,3-d)pyrimidine-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2-methylpropyl)-2,4-dioxo-7-propan-2-ylpyrido[2,3-d]pyrimidine-5-carboxylic acid (CAS 930495-18-4) is a chemical compound with the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. IUPAC name: 1-(2-methylpropyl)-2,4-dioxo-7-propan-2-ylpyrido[2,3-d]pyrimidine-5-carboxylic acid. InChIKey: ZSKISIZGBLPYRV-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O4 |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | 1-(2-methylpropyl)-2,4-dioxo-7-propan-2-ylpyrido[2,3-d]pyrimidine-5-carboxylic acid |
| InChIKey | ZSKISIZGBLPYRV-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C2=C(C(=CC(=N2)C(C)C)C(=O)O)C(=O)NC1=O |
Computed by PubChem (NCBI)