cas: 2763038-63-5 — see every product listed under this CAS number, including other names
6'-chlorospiro[4,5-dihydro-2H-1,5-benzoxazepine-3,1'-tetralin]-7-carboxylic acid, 97% (CAS 2763038-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1333OE-100mg |
| cas | 2763038-63-5 |
| size | 100mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2085.20 Pln | |
| Chemat | 250mg | 2757.20 Pln | |
| Chemat | 500mg | 3837.20 Pln | |
| Chemat | 1g | 5454.80 Pln | |
| Fluorochem | 100mg | 3855.95 Pln | |
| Fluorochem | 250mg | 5110.72 Pln | |
| Fluorochem | 500mg | 6985.06 Pln | |
| Fluorochem | 1g | 9947.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-chlorospiro[2,3-dihydro-1H-naphthalene-4,3'-4,5-dihydro-2H-1,5-benzoxazepine]-7'-carboxylic acid (CAS 2763038-63-5) is a chemical compound with the molecular formula C19H18ClNO3 and a molecular weight of 343.8 g/mol. IUPAC name: 7-chlorospiro[2,3-dihydro-1H-naphthalene-4,3'-4,5-dihydro-2H-1,5-benzoxazepine]-7'-carboxylic acid. InChIKey: JXZIUGGBWCCSFA-UHFFFAOYSA-N.
| Molecular formula | C19H18ClNO3 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 7-chlorospiro[2,3-dihydro-1H-naphthalene-4,3'-4,5-dihydro-2H-1,5-benzoxazepine]-7'-carboxylic acid |
| InChIKey | JXZIUGGBWCCSFA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C3(C1)CNC4=C(C=CC(=C4)C(=O)O)OC3 |
Computed by PubChem (NCBI)