CAS 4584-39-8 is the registry number for 2-(1-(4-Chlorobenzyl)-5-methoxy-2-methyl-1H-indol-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 500mg.
2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]acetic acid (CAS 4584-39-8) is a chemical compound with the molecular formula C19H18ClNO3 and a molecular weight of 343.8 g/mol. IUPAC name: 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]acetic acid. InChIKey: ZCEPWIDYPWMCOY-UHFFFAOYSA-N.
| Molecular formula | C19H18ClNO3 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]acetic acid |
| InChIKey | ZCEPWIDYPWMCOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1CC3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)O |
Computed by PubChem (NCBI)