6,11-Dihydrodibenzo[b,e]thiepin-11-one, 98%
cas: 1531-77-7 — see every product listed under this CAS number, including other names
6,11-Dihydrodibenzo[b,e]thiepin-11-one, 98% (CAS 1531-77-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A265211-5g |
| cas | 1531-77-7 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 309.19 Pln | |
| Ambeed | 100g | 704.12 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 515.60 Pln | |
| Chemat | 500g | 1752.00 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 25g | 325.47 Pln | |
| BLDpharm | 100g | 753.09 Pln | |
| BLDpharm | 500g | 3485.46 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6H-benzo[c][1]benzothiepin-11-one (CAS 1531-77-7) is a chemical compound with the molecular formula C14H10OS and a molecular weight of 226.30 g/mol. IUPAC name: 6H-benzo[c][1]benzothiepin-11-one. InChIKey: JGJDEWXZEIHBNW-UHFFFAOYSA-N.
| Molecular formula | C14H10OS |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 6H-benzo[c][1]benzothiepin-11-one |
| InChIKey | JGJDEWXZEIHBNW-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)C3=CC=CC=C3S1 |
Computed by PubChem (NCBI)
Synonyms:
Dibenzo[b,e]thiepin-11(6H)-one, Dibenzo(b,e)thiepin-11(6H)-one, 6,11-Dihydrodibenzo[b,e]thiepin-11-one, Homothioxanthone, 6H-benzo[c][1]benzothiepin-11-one, 6,11-Dihydrodibenzo(b,e)thiepin-11-one, Dibenz[b,e]thiepin-11(6H)-one, 1-Oxo-6,11-dihydrodibenzo[b,e]thiepin, Baloxavir impurity C050, 6,11-Dihydrodibenzo[b,e]thiep
![Dibenzo[b,e]thiepin-11(6H)-one, 95.0%](https://cdn.chemat.com.pl/products/images/bd2763e875b7fd3d28e1a8529b256bc048db9d83c94f127301f50bc0052ba2a6.svg)