CAS 65540-08-1 is the registry number for 4-[Benzo(b)thiophen-2-yl]phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(1-benzothiophen-2-yl)phenol (CAS 65540-08-1) is a chemical compound with the molecular formula C14H10OS and a molecular weight of 226.30 g/mol. IUPAC name: 4-(1-benzothiophen-2-yl)phenol. InChIKey: BTHAMNJTBJFIQX-UHFFFAOYSA-N.
| Molecular formula | C14H10OS |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 4-(1-benzothiophen-2-yl)phenol |
| InChIKey | BTHAMNJTBJFIQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)