Products 1531-77-7
CAS 1531-77-7 appears in our catalog under these names: Dibenzo[b,e]thiepin-11(6h)-one, 98%, Homothioxanthone, Dosulepin EP Impurity B, 6,11–Dihydrodibenzo(b,e)thiepin–11–one, 6,11-Dihydrodibenzo[b,e]thiepin-11-one, >98.0%(GC). Offered by: Combi-blocks, TRC, Mikromol, GLPBio, TCI. Available pack sizes: 1g, 25g, 100g, 5g, 100mg, 500mg, 25mg, 500g.
6H-benzo[c][1]benzothiepin-11-one (CAS 1531-77-7) is a chemical compound with the molecular formula C14H10OS and a molecular weight of 226.30 g/mol. IUPAC name: 6H-benzo[c][1]benzothiepin-11-one. InChIKey: JGJDEWXZEIHBNW-UHFFFAOYSA-N.
| Molecular formula | C14H10OS |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 6H-benzo[c][1]benzothiepin-11-one |
| InChIKey | JGJDEWXZEIHBNW-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)C3=CC=CC=C3S1 |
Computed by PubChem (NCBI)
Synonyms:
Dibenzo[b,e]thiepin-11(6H)-one, Dibenzo(b,e)thiepin-11(6H)-one, 6,11-Dihydrodibenzo[b,e]thiepin-11-one, Homothioxanthone, 6H-benzo[c][1]benzothiepin-11-one, 6,11-Dihydrodibenzo(b,e)thiepin-11-one, Dibenz[b,e]thiepin-11(6H)-one, 1-Oxo-6,11-dihydrodibenzo[b,e]thiepin, Baloxavir impurity C050, 6,11-Dihydrodibenzo[b,e]thiep