Products 583886-92-4
CAS 583886-92-4 is the registry number for 6-(2-Thienyl)-2-naphthol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
6-thiophen-2-ylnaphthalen-2-ol (CAS 583886-92-4) is a chemical compound with the molecular formula C14H10OS and a molecular weight of 226.30 g/mol. IUPAC name: 6-thiophen-2-ylnaphthalen-2-ol. InChIKey: ARBVMTSHHLXSIM-UHFFFAOYSA-N.
| Molecular formula | C14H10OS |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 6-thiophen-2-ylnaphthalen-2-ol |
| InChIKey | ARBVMTSHHLXSIM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC3=C(C=C2)C=C(C=C3)O |
Computed by PubChem (NCBI)