cas: 57817-08-0 — see every product listed under this CAS number, including other names
6,7-Dichloro-1H-indole 95% (CAS 57817-08-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A364001-100mg |
| cas | 57817-08-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3507.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A364001 |
6,7-dichloro-1H-indole (CAS 57817-08-0) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 6,7-dichloro-1H-indole. InChIKey: UWHWAXCLSNQVAG-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole |
| InChIKey | UWHWAXCLSNQVAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)Cl)Cl |
Computed by PubChem (NCBI)