cas: 57817-08-0 — see every product listed under this CAS number, including other names
6,7-Dichloro-1H-indole, 95%, 95% (CAS 57817-08-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F20T-100mg |
| cas | 57817-08-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1994.00 Pln | |
| Chemat | 10g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6,7-dichloro-1H-indole (CAS 57817-08-0) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 6,7-dichloro-1H-indole. InChIKey: UWHWAXCLSNQVAG-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole |
| InChIKey | UWHWAXCLSNQVAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)Cl)Cl |
Computed by PubChem (NCBI)