cas: 69300-50-1 — see every product listed under this CAS number, including other names
6,7-Dihydro-5H-spiro[benzo[b]thiophene-4,4'-imidazolidine]-2',5'-dione 97% (CAS 69300-50-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A340452-100mg |
| cas | 69300-50-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 1955.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A340452 |
Spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (CAS 69300-50-1) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione. InChIKey: CWFRYKWJIHQOFY-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| InChIKey | CWFRYKWJIHQOFY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CS2)C3(C1)C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)