6,8-Dichloro-[1,2,4]triazolo[1,5-a]pyrazine, 95%
cas: 2092807-41-3 — see every product listed under this CAS number, including other names
6,8-Dichloro-[1,2,4]triazolo[1,5-a]pyrazine, 95% (CAS 2092807-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A331157-100mg |
| cas | 2092807-41-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 509.44 Pln | |
| Ambeed | 5g | 2094.75 Pln | |
| Ambeed | 10g | 4063.88 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 542.06 Pln | |
| BLDpharm | 5g | 2252.56 Pln | |
| BLDpharm | 10g | 4379.59 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine (CAS 2092807-41-3) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 6,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine. InChIKey: OCSYMVSTAPNMIF-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 6,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine |
| InChIKey | OCSYMVSTAPNMIF-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C2=NC=NN21)Cl)Cl |
Computed by PubChem (NCBI)