CAS 2092807-41-3 appears in our catalog under these names: 6,8-Dichloro-[1,2,4]triazolo[1,5-a]pyrazine, 95%, 95%, 6,8-Dichloro-[1,2,4]triazolo[1,5-a]pyrazine, 97%, 6,8-Dichloro-[1,2,4]triazolo[1,5-a]pyrazine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
6,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine (CAS 2092807-41-3) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 6,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine. InChIKey: OCSYMVSTAPNMIF-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 6,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine |
| InChIKey | OCSYMVSTAPNMIF-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C2=NC=NN21)Cl)Cl |
Computed by PubChem (NCBI)