cas: 858516-69-5 — see every product listed under this CAS number, including other names
6,8-Dichloroimidazo[1,2-a]pyridine 97% (CAS 858516-69-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194734-1g |
| cas | 858516-69-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 10g | 348.12 Pln | |
| Ambeed | 25g | 748.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A194734 |
6,8-dichloroimidazo[1,2-a]pyridine (CAS 858516-69-5) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 6,8-dichloroimidazo[1,2-a]pyridine. InChIKey: ZAHCPJDXWPIZSL-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 6,8-dichloroimidazo[1,2-a]pyridine |
| InChIKey | ZAHCPJDXWPIZSL-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Cl)Cl |
Computed by PubChem (NCBI)