cas: 6402-23-9 — see every product listed under this CAS number, including other names
6,9-diamino-2-ethoxy-Acridine,lactate, hydrate, 98%, 98% (CAS 6402-23-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PYE-1g |
| cas | 6402-23-9 |
| size | 1g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 251.60 Pln | |
| Chemat | 100g | 722.00 Pln | |
| Chemat | 500g | 3004.80 Pln | |
| Chemat | 1kg | 5066.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate (CAS 6402-23-9) is a chemical compound with the molecular formula C18H23N3O5 and a molecular weight of 361.4 g/mol. IUPAC name: 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate. InChIKey: NYEPHMYJRNWPLA-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate |
| InChIKey | NYEPHMYJRNWPLA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N)N=C2C=C1)N.CC(C(=O)O)O.O |
Computed by PubChem (NCBI)