cas: 6402-23-9 — see every product listed under this CAS number, including other names
Ethacridine (lactate monohydrate), 99.85% (CAS 6402-23-9) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0889-10mM/1mL |
| cas | 6402-23-9 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 100 mg | 310.40 Pln | |
| MedChemExpress | 50 mg | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.85% |
7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate (CAS 6402-23-9) is a chemical compound with the molecular formula C18H23N3O5 and a molecular weight of 361.4 g/mol. IUPAC name: 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate. InChIKey: NYEPHMYJRNWPLA-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate |
| InChIKey | NYEPHMYJRNWPLA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N)N=C2C=C1)N.CC(C(=O)O)O.O |
Computed by PubChem (NCBI)