CAS 6402-23-9 appears in our catalog under these names: Ethacridine lactate monohydrate, 98%, Ethacridine Lactate Monohydrate, >95% (HPLC), Ethacridine Lactate Monohydrate, Ethacridine lactate monohydrate/ 99.96% (existing batch purity), 6,9-Diamino-2-ethoxyacridine lactate monohydrate, 95%. Offered by: Combi-blocks, TRC, Mikromol, LoGiCal, Dr. Ehrenstorfer. Available pack sizes: 25g, 1g, 5g, 10g, 250mg, 10mg, 100mg, 500mg.
7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate (CAS 6402-23-9) is a chemical compound with the molecular formula C18H23N3O5 and a molecular weight of 361.4 g/mol. IUPAC name: 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate. InChIKey: NYEPHMYJRNWPLA-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate |
| InChIKey | NYEPHMYJRNWPLA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N)N=C2C=C1)N.CC(C(=O)O)O.O |
Computed by PubChem (NCBI)