cas: 6402-23-9 — see every product listed under this CAS number, including other names
Ethacridine lactate salt monohydrate, 99.00% (CAS 6402-23-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM34380A-100g |
| cas | 6402-23-9 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 842.53 Pln | |
| Chemat | 10g | 163.01 Pln | |
| Chemat | 25g | 276.06 Pln | |
| Chemat | 5g | 131.72 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.00% |
| category | Chemicals |
7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate (CAS 6402-23-9) is a chemical compound with the molecular formula C18H23N3O5 and a molecular weight of 361.4 g/mol. IUPAC name: 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate. InChIKey: NYEPHMYJRNWPLA-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 7-ethoxyacridine-3,9-diamine;2-hydroxypropanoic acid;hydrate |
| InChIKey | NYEPHMYJRNWPLA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N)N=C2C=C1)N.CC(C(=O)O)O.O |
Computed by PubChem (NCBI)