cas: 1346702-54-2 — see every product listed under this CAS number, including other names
6–Bromo–1–isopropyl–1H–indazole–4–carboxylic acid (CAS 1346702-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF20027-100mg |
| cas | 1346702-54-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 545.55 Pln | |
| GLPBio | 1g | 1037.01 Pln | |
| GLPBio | 250mg | 653.21 Pln | |
| GLPBio | 5g | 3531.71 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-bromo-1-propan-2-ylindazole-4-carboxylic acid (CAS 1346702-54-2) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 6-bromo-1-propan-2-ylindazole-4-carboxylic acid. InChIKey: ALIFNHAOTSEACG-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 6-bromo-1-propan-2-ylindazole-4-carboxylic acid |
| InChIKey | ALIFNHAOTSEACG-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=CC(=CC(=C2C=N1)C(=O)O)Br |
Computed by PubChem (NCBI)