Products 25197-99-3
CAS 25197-99-3 appears in our catalog under these names: (S)-2-Amino-3-(5-bromo-1H-indol-3-yl)propanoic acid, 97%, 5-Bromo-L-tryptophan, 95%, L-5-BromoTryptophan, 5–Bromo–L–tryptophan, 5-Bromo-L-tryptophan. Offered by: Fluorochem, Combi-blocks, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25mg, 50mg, 500mg.
(2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid (CAS 25197-99-3) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid. InChIKey: KZDNJQUJBMDHJW-VIFPVBQESA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | KZDNJQUJBMDHJW-VIFPVBQESA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
5-Bromo-L-tryptophan, (S)-2-Amino-3-(5-bromo-1H-indol-3-yl)propanoic acid, L-tryptophan, 5-bromo-, (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid, 5BrW, (S)-2-Amino-3-(5-bromo-1H-indol-3-yl)propanoicacid, Tryptophan, 5-bromo-, H-Trp(5-Br)-OH, L-Trp(5-Br)-OH, L-5-BromoTryptophan(5-BrW)