cas: 94166-62-8 — see every product listed under this CAS number, including other names
6–methoxy–2,3–diaminopyridine hydrochloride (CAS 94166-62-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF18997-1g |
| cas | 94166-62-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 915.31 Pln | |
| GLPBio | 250mg | 601.72 Pln | |
| GLPBio | 5g | 2174.37 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-methoxypyridine-2,3-diamine;dihydrochloride (CAS 94166-62-8) is a chemical compound with the molecular formula C6H11Cl2N3O and a molecular weight of 212.07 g/mol. IUPAC name: 6-methoxypyridine-2,3-diamine;dihydrochloride. InChIKey: HFTXXPTXSCLIIP-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2N3O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 6-methoxypyridine-2,3-diamine;dihydrochloride |
| InChIKey | HFTXXPTXSCLIIP-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)