cas: 94166-62-8 — see every product listed under this CAS number, including other names
6-Methoxypyridine-2,3-diamine dihydrochloride, 98% (CAS 94166-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242894-100MG |
| cas | 94166-62-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 2403.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxypyridine-2,3-diamine;dihydrochloride (CAS 94166-62-8) is a chemical compound with the molecular formula C6H11Cl2N3O and a molecular weight of 212.07 g/mol. IUPAC name: 6-methoxypyridine-2,3-diamine;dihydrochloride. InChIKey: HFTXXPTXSCLIIP-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2N3O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 6-methoxypyridine-2,3-diamine;dihydrochloride |
| InChIKey | HFTXXPTXSCLIIP-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)