cas: 906352-78-1 — see every product listed under this CAS number, including other names
6-((Tetrahydro-2H-pyran-4-yl)oxy)picolinic acid, 95+% (CAS 906352-78-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A527650-5g |
| cas | 906352-78-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11898.67 Pln | |
| AmBeed | 1g | 6840.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-(oxan-4-yloxy)pyridine-2-carboxylic acid (CAS 906352-78-1) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 6-(oxan-4-yloxy)pyridine-2-carboxylic acid. InChIKey: UEWVONKWINVFRW-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 6-(oxan-4-yloxy)pyridine-2-carboxylic acid |
| InChIKey | UEWVONKWINVFRW-UHFFFAOYSA-N |
| SMILES | C1COCCC1OC2=CC=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)