cas: 906352-78-1 — see every product listed under this CAS number, including other names
6-(Tetrahydropyran-4-yloxy)pyridine-2-carboxylic acid, 97% (CAS 906352-78-1) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC58201CB |
| cas | 906352-78-1 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 243.85 Pln | |
| Thermo Scientific | 1g | 712.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
6-(oxan-4-yloxy)pyridine-2-carboxylic acid (CAS 906352-78-1) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 6-(oxan-4-yloxy)pyridine-2-carboxylic acid. InChIKey: UEWVONKWINVFRW-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 6-(oxan-4-yloxy)pyridine-2-carboxylic acid |
| InChIKey | UEWVONKWINVFRW-UHFFFAOYSA-N |
| SMILES | C1COCCC1OC2=CC=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)