cas: 258497-21-1 — see every product listed under this CAS number, including other names
6-((tert-Butoxycarbonyl)amino)picolinic acid, 97%, 97% (CAS 258497-21-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118NKX-50mg |
| cas | 258497-21-1 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 141.20 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 654.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid (CAS 258497-21-1) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid. InChIKey: GNGCSXRLPFHKIO-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid |
| InChIKey | GNGCSXRLPFHKIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=N1)C(=O)O |
Computed by PubChem (NCBI)