6-((tert-Butoxycarbonyl)amino)picolinic acid, 98%
cas: 258497-21-1 — see every product listed under this CAS number, including other names
6-((tert-Butoxycarbonyl)amino)picolinic acid, 98% (CAS 258497-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A884011-100mg |
| cas | 258497-21-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 431.56 Pln | |
| Ambeed | 1g | 798.69 Pln | |
| Ambeed | 5g | 2623.19 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 425.43 Pln | |
| BLDpharm | 1g | 858.61 Pln | |
| BLDpharm | 5g | 2819.03 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 5g | 2684.49 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid (CAS 258497-21-1) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid. InChIKey: GNGCSXRLPFHKIO-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid |
| InChIKey | GNGCSXRLPFHKIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=N1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-{[(tert-butoxy)carbonyl]amino}pyridine-2-carboxylic acid, 6-(((Tert-butoxy)carbonyl)amino)pyridine-2-carboxylic acid, 6-((tert-Butoxycarbonyl)amino)picolinic acid, 6-N-Boc-aminopicolinic acid, 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid, 6-[(tert-butoxycarbonyl)amino]-2-pyridinecarboxylic acid, 6-(Boc-amino)picolinic Acid, 6-(Boc-amino)-picolinic Acid, 6-(tert-butoxycarbonylamino)pyridine-2-carboxylic acid, GNGCSXRLPFHKIO-UHFFFAOYSA-N