CAS 231958-14-8 appears in our catalog under these names: 6-[(tert-Butoxycarbonyl)amino]nicotinic acid, 98%, 6–((tert–Butoxycarbonyl)amino)nicotinic acid, 6-((tert-Butoxycarbonyl)amino)nicotinic acid, 6-((tert-Butoxycarbonyl)amino)nicotinic acid 97%, 6-((tert-Butoxycarbonyl)amino)nicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 2,5g, 100mg.
6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid (CAS 231958-14-8) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid. InChIKey: STXYMSGJQJBIHL-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylic acid |
| InChIKey | STXYMSGJQJBIHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)