cas: 863704-38-5 — see every product listed under this CAS number, including other names
6-(3-CHLOROPHENYL)-2-PYRIDINECARBOXYLIC ACID (CAS 863704-38-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F835784-1G |
| cas | 863704-38-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1606.74 Pln | |
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 5g | 7500.50 Pln |
| delivery time | 3-4 weeks |
|---|
6-(3-chlorophenyl)pyridine-2-carboxylic acid (CAS 863704-38-5) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 6-(3-chlorophenyl)pyridine-2-carboxylic acid. InChIKey: GLIPKPBSIZTPBM-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 6-(3-chlorophenyl)pyridine-2-carboxylic acid |
| InChIKey | GLIPKPBSIZTPBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)