Products 1214352-99-4

CAS 1214352-99-4 is the registry number for 6-Chloro-5-phenylpicolinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

6-chloro-5-phenylpyridine-2-carboxylic acid (CAS 1214352-99-4) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 6-chloro-5-phenylpyridine-2-carboxylic acid. InChIKey: ZQVTXPUVKSEURY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClNO2
Molecular weight233.65 g/mol
IUPAC name6-chloro-5-phenylpyridine-2-carboxylic acid
InChIKeyZQVTXPUVKSEURY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(N=C(C=C2)C(=O)O)Cl

Computed by PubChem (NCBI)